Index: util/win/process_info.cc |
diff --git a/util/win/process_info.cc b/util/win/process_info.cc |
index 66157aa482c1efccecb849014a3444851c161cdf..46ef67a4b31b81469c0176f6170c6df69b9b9714 100644 |
--- a/util/win/process_info.cc |
+++ b/util/win/process_info.cc |
@@ -14,7 +14,10 @@ |
#include "util/win/process_info.h" |
+#include <winternl.h> |
+ |
#include "base/logging.h" |
+#include "util/win/process_structs.h" |
namespace crashpad { |
@@ -50,8 +53,9 @@ bool IsProcessWow64(HANDLE process_handle) { |
return is_wow64; |
} |
+template <class T> |
bool ReadUnicodeString(HANDLE process, |
- const UNICODE_STRING& us, |
+ const UNICODE_STRING_T<T>& us, |
std::wstring* result) { |
if (us.Length == 0) { |
result->clear(); |
@@ -60,8 +64,11 @@ bool ReadUnicodeString(HANDLE process, |
DCHECK_EQ(us.Length % sizeof(wchar_t), 0u); |
result->resize(us.Length / sizeof(wchar_t)); |
SIZE_T bytes_read; |
- if (!ReadProcessMemory( |
- process, us.Buffer, &result->operator[](0), us.Length, &bytes_read)) { |
+ if (!ReadProcessMemory(process, |
+ reinterpret_cast<const void*>(us.Buffer), |
+ &result->operator[](0), |
+ us.Length, |
+ &bytes_read)) { |
PLOG(ERROR) << "ReadProcessMemory UNICODE_STRING"; |
return false; |
} |
@@ -91,35 +98,83 @@ template <class T> bool ReadStruct(HANDLE process, uintptr_t at, T* into) { |
return true; |
} |
-// PEB_LDR_DATA in winternl.h doesn't document the trailing |
-// InInitializationOrderModuleList field. See `dt ntdll!PEB_LDR_DATA`. |
-struct FULL_PEB_LDR_DATA : public PEB_LDR_DATA { |
- LIST_ENTRY InInitializationOrderModuleList; |
-}; |
- |
-// LDR_DATA_TABLE_ENTRY doesn't include InInitializationOrderLinks, define a |
-// complete version here. See `dt ntdll!_LDR_DATA_TABLE_ENTRY`. |
-struct FULL_LDR_DATA_TABLE_ENTRY { |
- LIST_ENTRY InLoadOrderLinks; |
- LIST_ENTRY InMemoryOrderLinks; |
- LIST_ENTRY InInitializationOrderLinks; |
- PVOID DllBase; |
- PVOID EntryPoint; |
- ULONG SizeOfImage; |
- UNICODE_STRING FullDllName; |
- UNICODE_STRING BaseDllName; |
- ULONG Flags; |
- WORD LoadCount; |
- WORD TlsIndex; |
- LIST_ENTRY HashLinks; |
- ULONG TimeDateStamp; |
- _ACTIVATION_CONTEXT* EntryPointActivationContext; |
-}; |
- |
} // namespace |
+template <class T> |
+bool ReadProcessData(HANDLE process, |
+ uintptr_t peb_address, |
Mark Mentovai
2015/03/09 16:11:46
peb_address is in the remote process’ address spac
scottmg
2015/03/09 21:16:36
Right, that's why. Done.
|
+ ProcessInfo* process_info) { |
+ // Try to read the process environment block. |
+ PEB_T<T> peb; |
+ if (!ReadStruct(process, peb_address, &peb)) |
+ return false; |
+ |
+ RTL_USER_PROCESS_PARAMETERS_T<T> process_parameters; |
+ if (!ReadStruct(process, peb.ProcessParameters, &process_parameters)) |
+ return false; |
+ |
+ if (!ReadUnicodeString(process, |
+ process_parameters.CommandLine, |
+ &process_info->command_line_)) { |
+ return false; |
+ } |
+ |
+ PEB_LDR_DATA_T<T> peb_ldr_data; |
+ if (!ReadStruct(process, peb.Ldr, &peb_ldr_data)) |
+ return false; |
+ |
+ // Include the first module in the memory order list to get our own name as |
+ // it's not included in initialization order below. |
+ std::wstring self_module; |
+ LDR_DATA_TABLE_ENTRY_T<T> self_ldr_data_table_entry; |
+ if (!ReadStruct(process, |
+ reinterpret_cast<uintptr_t>( |
+ reinterpret_cast<const char*>( |
+ peb_ldr_data.InMemoryOrderModuleList.Flink) - |
+ offsetof(LDR_DATA_TABLE_ENTRY_T<T>, InMemoryOrderLinks)), |
+ &self_ldr_data_table_entry)) { |
+ return false; |
+ } |
+ if (!ReadUnicodeString( |
+ process, self_ldr_data_table_entry.FullDllName, &self_module)) { |
+ return false; |
+ } |
+ process_info->modules_.push_back(self_module); |
+ |
+ // Walk the PEB LDR structure (doubly-linked list) to get the list of loaded |
+ // modules. We use this method rather than EnumProcessModules to get the |
+ // modules in initialization order rather than memory order. |
+ T last = peb_ldr_data.InInitializationOrderModuleList.Blink; |
+ LDR_DATA_TABLE_ENTRY_T<T> ldr_data_table_entry; |
+ for (T cur = peb_ldr_data.InInitializationOrderModuleList.Flink;; |
+ cur = ldr_data_table_entry.InInitializationOrderLinks.Flink) { |
+ // |cur| is the pointer to the LIST_ENTRY embedded in the |
+ // LDR_DATA_TABLE_ENTRY, in the target process's address space. So we need |
+ // to read from the target, and also offset back to the beginning of the |
+ // structure. |
+ if (!ReadStruct( |
+ process, |
+ reinterpret_cast<uintptr_t>(reinterpret_cast<const char*>(cur) - |
+ offsetof(LDR_DATA_TABLE_ENTRY_T<T>, |
+ InInitializationOrderLinks)), |
+ &ldr_data_table_entry)) { |
+ break; |
+ } |
+ // TODO(scottmg): Capture TimeDateStamp, Checksum, etc. too? |
+ std::wstring module; |
+ if (!ReadUnicodeString(process, ldr_data_table_entry.FullDllName, &module)) |
+ break; |
+ process_info->modules_.push_back(module); |
+ if (cur == last) |
+ break; |
+ } |
+ |
+ return true; |
+} |
+ |
ProcessInfo::ProcessInfo() |
- : process_basic_information_(), |
+ : process_id_(), |
+ inherited_from_process_id_(), |
command_line_(), |
modules_(), |
is_64_bit_(false), |
@@ -147,12 +202,7 @@ bool ProcessInfo::Initialize(HANDLE process) { |
system_info.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64; |
} |
-#if ARCH_CPU_64_BITS |
- if (!is_64_bit_) { |
- LOG(ERROR) << "Reading different bitness not yet supported"; |
- return false; |
- } |
-#else |
+#if ARCH_CPU_32_BITS |
if (is_64_bit_) { |
LOG(ERROR) << "Reading x64 process from x86 process not supported"; |
return false; |
@@ -160,93 +210,62 @@ bool ProcessInfo::Initialize(HANDLE process) { |
#endif |
ULONG bytes_returned; |
+ // We assume this process is not running on Wow64. The |
Mark Mentovai
2015/03/09 16:11:46
I don’t think that this assumption can really hold
scottmg
2015/03/09 21:16:36
OK. I would prefer not to support running as Wow64
|
+ // PROCESS_BASIC_INFORMATION uses the OS size (that is, even Wow64 has a 64 |
+ // bit one.) |
+#if ARCH_CPU_32_BITS |
+ PROCESS_BASIC_INFORMATION_T<DWORD> process_basic_information; |
+#else |
+ PROCESS_BASIC_INFORMATION_T<DWORD64> process_basic_information; |
+#endif |
NTSTATUS status = |
crashpad::NtQueryInformationProcess(process, |
ProcessBasicInformation, |
- &process_basic_information_, |
- sizeof(process_basic_information_), |
+ &process_basic_information, |
+ sizeof(process_basic_information), |
&bytes_returned); |
if (status < 0) { |
LOG(ERROR) << "NtQueryInformationProcess: status=" << status; |
return false; |
} |
- if (bytes_returned != sizeof(process_basic_information_)) { |
+ if (bytes_returned != sizeof(process_basic_information)) { |
LOG(ERROR) << "NtQueryInformationProcess incorrect size"; |
return false; |
} |
- |
- // Try to read the process environment block. |
- PEB peb; |
- if (!ReadStruct(process, |
- reinterpret_cast<uintptr_t>( |
- process_basic_information_.PebBaseAddress), |
- &peb)) { |
- return false; |
- } |
- |
- RTL_USER_PROCESS_PARAMETERS process_parameters; |
- if (!ReadStruct(process, |
- reinterpret_cast<uintptr_t>(peb.ProcessParameters), |
- &process_parameters)) { |
- return false; |
- } |
- |
- if (!ReadUnicodeString( |
- process, process_parameters.CommandLine, &command_line_)) { |
- return false; |
+ process_id_ = process_basic_information.UniqueProcessId; |
+ inherited_from_process_id_ = |
+ process_basic_information.InheritedFromUniqueProcessId; |
+ |
+ // We now want to read the PEB to gather the rest of our information. The |
+ // PebBaseAddress as returned above is what we want for 64-on-64 and 32-on-32, |
+ // but for Wow64, we want to read the 32 bit PEB (a Wow64 process has both). |
+ // The address of this is found by a second call to NtQueryInformationProcess. |
+ uintptr_t peb_address = process_basic_information.PebBaseAddress; |
+ if (is_wow64_) { |
+ ULONG_PTR wow64_peb_address; |
+ status = |
+ crashpad::NtQueryInformationProcess(process, |
+ ProcessWow64Information, |
+ &wow64_peb_address, |
+ sizeof(wow64_peb_address), |
+ &bytes_returned); |
+ if (status < 0) { |
+ LOG(ERROR) << "NtQueryInformationProcess: status=" << status; |
+ return false; |
+ } |
+ if (bytes_returned != sizeof(wow64_peb_address)) { |
+ LOG(ERROR) << "NtQueryInformationProcess incorrect size"; |
+ return false; |
+ } |
+ peb_address = wow64_peb_address; |
} |
- FULL_PEB_LDR_DATA peb_ldr_data; |
- if (!ReadStruct(process, reinterpret_cast<uintptr_t>(peb.Ldr), &peb_ldr_data)) |
- return false; |
- |
- // Include the first module in the memory order list to get our own name as |
- // it's not included in initialization order below. |
- std::wstring self_module; |
- FULL_LDR_DATA_TABLE_ENTRY self_ldr_data_table_entry; |
- if (!ReadStruct(process, |
- reinterpret_cast<uintptr_t>( |
- reinterpret_cast<const char*>( |
- peb_ldr_data.InMemoryOrderModuleList.Flink) - |
- offsetof(FULL_LDR_DATA_TABLE_ENTRY, InMemoryOrderLinks)), |
- &self_ldr_data_table_entry)) { |
+ // Read the PEB data using the correct word size. |
+ bool result = is_64_bit_ |
+ ? ReadProcessData<DWORD64>(process, peb_address, this) |
+ : ReadProcessData<DWORD>(process, peb_address, this); |
+ if (!result) |
return false; |
- } |
- if (!ReadUnicodeString( |
- process, self_ldr_data_table_entry.FullDllName, &self_module)) { |
- return false; |
- } |
- modules_.push_back(self_module); |
- |
- // Walk the PEB LDR structure (doubly-linked list) to get the list of loaded |
- // modules. We use this method rather than EnumProcessModules to get the |
- // modules in initialization order rather than memory order. |
- const LIST_ENTRY* last = peb_ldr_data.InInitializationOrderModuleList.Blink; |
- FULL_LDR_DATA_TABLE_ENTRY ldr_data_table_entry; |
- for (const LIST_ENTRY* cur = |
- peb_ldr_data.InInitializationOrderModuleList.Flink; |
- ; |
- cur = ldr_data_table_entry.InInitializationOrderLinks.Flink) { |
- // |cur| is the pointer to the LIST_ENTRY embedded in the |
- // FULL_LDR_DATA_TABLE_ENTRY, in the target process's address space. So we |
- // need to read from the target, and also offset back to the beginning of |
- // the structure. |
- if (!ReadStruct( |
- process, |
- reinterpret_cast<uintptr_t>(reinterpret_cast<const char*>(cur) - |
- offsetof(FULL_LDR_DATA_TABLE_ENTRY, |
- InInitializationOrderLinks)), |
- &ldr_data_table_entry)) { |
- break; |
- } |
- // TODO(scottmg): Capture TimeDateStamp, Checksum, etc. too? |
- std::wstring module; |
- if (!ReadUnicodeString(process, ldr_data_table_entry.FullDllName, &module)) |
- break; |
- modules_.push_back(module); |
- if (cur == last) |
- break; |
- } |
INITIALIZATION_STATE_SET_VALID(initialized_); |
return true; |
@@ -264,12 +283,12 @@ bool ProcessInfo::IsWow64() const { |
pid_t ProcessInfo::ProcessID() const { |
INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
- return process_basic_information_.UniqueProcessId; |
+ return process_id_; |
} |
pid_t ProcessInfo::ParentProcessID() const { |
INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
- return process_basic_information_.InheritedFromUniqueProcessId; |
+ return inherited_from_process_id_; |
} |
bool ProcessInfo::CommandLine(std::wstring* command_line) const { |