| OLD | NEW |
| (Empty) | |
| 1 // Copyright 2015 The Crashpad Authors. All rights reserved. |
| 2 // |
| 3 // Licensed under the Apache License, Version 2.0 (the "License"); |
| 4 // you may not use this file except in compliance with the License. |
| 5 // You may obtain a copy of the License at |
| 6 // |
| 7 // http://www.apache.org/licenses/LICENSE-2.0 |
| 8 // |
| 9 // Unless required by applicable law or agreed to in writing, software |
| 10 // distributed under the License is distributed on an "AS IS" BASIS, |
| 11 // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| 12 // See the License for the specific language governing permissions and |
| 13 // limitations under the License. |
| 14 |
| 15 #include "util/win/process_info.h" |
| 16 |
| 17 #include "base/logging.h" |
| 18 |
| 19 namespace crashpad { |
| 20 |
| 21 namespace { |
| 22 |
| 23 NTSTATUS NtQueryInformationProcess(HANDLE process_handle, |
| 24 PROCESSINFOCLASS process_information_class, |
| 25 PVOID process_information, |
| 26 ULONG process_information_length, |
| 27 PULONG return_length) { |
| 28 static decltype(::NtQueryInformationProcess)* nt_query_information_process = |
| 29 reinterpret_cast<decltype(::NtQueryInformationProcess)*>(GetProcAddress( |
| 30 LoadLibrary(L"ntdll.dll"), "NtQueryInformationProcess")); |
| 31 DCHECK(nt_query_information_process); |
| 32 return nt_query_information_process(process_handle, |
| 33 process_information_class, |
| 34 process_information, |
| 35 process_information_length, |
| 36 return_length); |
| 37 } |
| 38 |
| 39 bool IsProcessWow64(HANDLE process_handle) { |
| 40 static decltype(IsWow64Process)* is_wow64_process = |
| 41 reinterpret_cast<decltype(IsWow64Process)*>( |
| 42 GetProcAddress(LoadLibrary(L"kernel32.dll"), "IsWow64Process")); |
| 43 if (!is_wow64_process) |
| 44 return false; |
| 45 BOOL is_wow64; |
| 46 if (!is_wow64_process(process_handle, &is_wow64)) { |
| 47 PLOG(ERROR) << "IsWow64Process"; |
| 48 return false; |
| 49 } |
| 50 return is_wow64; |
| 51 } |
| 52 |
| 53 bool ReadUnicodeString(HANDLE process, |
| 54 const UNICODE_STRING& us, |
| 55 std::wstring* result) { |
| 56 if (us.Length == 0) { |
| 57 result->clear(); |
| 58 return true; |
| 59 } |
| 60 DCHECK_EQ(us.Length % sizeof(wchar_t), 0u); |
| 61 result->resize(us.Length / sizeof(wchar_t)); |
| 62 SIZE_T bytes_read; |
| 63 if (!ReadProcessMemory( |
| 64 process, us.Buffer, &result->operator[](0), us.Length, &bytes_read)) { |
| 65 PLOG(ERROR) << "ReadProcessMemory UNICODE_STRING"; |
| 66 return false; |
| 67 } |
| 68 if (bytes_read != us.Length) { |
| 69 LOG(ERROR) << "ReadProcessMemory UNICODE_STRING incorrect size"; |
| 70 return false; |
| 71 } |
| 72 return true; |
| 73 } |
| 74 |
| 75 template <class T> bool ReadStruct(HANDLE process, uintptr_t at, T* into) { |
| 76 SIZE_T bytes_read; |
| 77 if (!ReadProcessMemory(process, |
| 78 reinterpret_cast<const void*>(at), |
| 79 into, |
| 80 sizeof(T), |
| 81 &bytes_read)) { |
| 82 // We don't have a name for the type we're reading, so include the signature |
| 83 // to get the type of T. |
| 84 PLOG(ERROR) << "ReadProcessMemory " << __FUNCSIG__; |
| 85 return false; |
| 86 } |
| 87 if (bytes_read != sizeof(T)) { |
| 88 LOG(ERROR) << "ReadProcessMemory " << __FUNCSIG__ << " incorrect size"; |
| 89 return false; |
| 90 } |
| 91 return true; |
| 92 } |
| 93 |
| 94 // PEB_LDR_DATA in winternl.h doesn't document the trailing |
| 95 // InInitializationOrderModuleList field. See `dt ntdll!PEB_LDR_DATA`. |
| 96 struct FULL_PEB_LDR_DATA : public PEB_LDR_DATA { |
| 97 LIST_ENTRY InInitializationOrderModuleList; |
| 98 }; |
| 99 |
| 100 // LDR_DATA_TABLE_ENTRY doesn't include InInitializationOrderLinks, define a |
| 101 // complete version here. See `dt ntdll!_LDR_DATA_TABLE_ENTRY`. |
| 102 struct FULL_LDR_DATA_TABLE_ENTRY { |
| 103 LIST_ENTRY InLoadOrderLinks; |
| 104 LIST_ENTRY InMemoryOrderLinks; |
| 105 LIST_ENTRY InInitializationOrderLinks; |
| 106 PVOID DllBase; |
| 107 PVOID EntryPoint; |
| 108 ULONG SizeOfImage; |
| 109 UNICODE_STRING FullDllName; |
| 110 UNICODE_STRING BaseDllName; |
| 111 ULONG Flags; |
| 112 WORD LoadCount; |
| 113 WORD TlsIndex; |
| 114 LIST_ENTRY HashLinks; |
| 115 ULONG TimeDateStamp; |
| 116 _ACTIVATION_CONTEXT* EntryPointActivationContext; |
| 117 }; |
| 118 |
| 119 } // namespace |
| 120 |
| 121 ProcessInfo::ProcessInfo() |
| 122 : process_basic_information_(), |
| 123 command_line_(), |
| 124 modules_(), |
| 125 is_64_bit_(false), |
| 126 is_wow64_(false), |
| 127 initialized_() { |
| 128 } |
| 129 |
| 130 ProcessInfo::~ProcessInfo() { |
| 131 } |
| 132 |
| 133 bool ProcessInfo::Initialize(HANDLE process) { |
| 134 INITIALIZATION_STATE_SET_INITIALIZING(initialized_); |
| 135 |
| 136 is_wow64_ = IsProcessWow64(process); |
| 137 |
| 138 if (is_wow64_) { |
| 139 // If it's WoW64, then it's 32-on-64. |
| 140 is_64_bit_ = false; |
| 141 } else { |
| 142 // Otherwise, it's either 32 on 32, or 64 on 64. Use GetSystemInfo() to |
| 143 // distinguish between these two cases. |
| 144 SYSTEM_INFO system_info; |
| 145 GetSystemInfo(&system_info); |
| 146 is_64_bit_ = |
| 147 system_info.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64; |
| 148 } |
| 149 |
| 150 #if ARCH_CPU_64_BITS |
| 151 if (!is_64_bit_) { |
| 152 LOG(ERROR) << "Reading different bitness not yet supported"; |
| 153 return false; |
| 154 } |
| 155 #else |
| 156 if (is_64_bit_) { |
| 157 LOG(ERROR) << "Reading x64 process from x86 process not supported"; |
| 158 return false; |
| 159 } |
| 160 #endif |
| 161 |
| 162 ULONG bytes_returned; |
| 163 NTSTATUS status = |
| 164 crashpad::NtQueryInformationProcess(process, |
| 165 ProcessBasicInformation, |
| 166 &process_basic_information_, |
| 167 sizeof(process_basic_information_), |
| 168 &bytes_returned); |
| 169 if (status < 0) { |
| 170 LOG(ERROR) << "NtQueryInformationProcess: status=" << status; |
| 171 return false; |
| 172 } |
| 173 if (bytes_returned != sizeof(process_basic_information_)) { |
| 174 LOG(ERROR) << "NtQueryInformationProcess incorrect size"; |
| 175 return false; |
| 176 } |
| 177 |
| 178 // Try to read the process environment block. |
| 179 PEB peb; |
| 180 if (!ReadStruct(process, |
| 181 reinterpret_cast<uintptr_t>( |
| 182 process_basic_information_.PebBaseAddress), |
| 183 &peb)) { |
| 184 return false; |
| 185 } |
| 186 |
| 187 RTL_USER_PROCESS_PARAMETERS process_parameters; |
| 188 if (!ReadStruct(process, |
| 189 reinterpret_cast<uintptr_t>(peb.ProcessParameters), |
| 190 &process_parameters)) { |
| 191 return false; |
| 192 } |
| 193 |
| 194 if (!ReadUnicodeString( |
| 195 process, process_parameters.CommandLine, &command_line_)) { |
| 196 return false; |
| 197 } |
| 198 |
| 199 FULL_PEB_LDR_DATA peb_ldr_data; |
| 200 if (!ReadStruct(process, reinterpret_cast<uintptr_t>(peb.Ldr), &peb_ldr_data)) |
| 201 return false; |
| 202 |
| 203 // Include the first module in the memory order list to get our own name as |
| 204 // it's not included in initialization order below. |
| 205 std::wstring self_module; |
| 206 FULL_LDR_DATA_TABLE_ENTRY self_ldr_data_table_entry; |
| 207 if (!ReadStruct(process, |
| 208 reinterpret_cast<uintptr_t>( |
| 209 reinterpret_cast<const char*>( |
| 210 peb_ldr_data.InMemoryOrderModuleList.Flink) - |
| 211 offsetof(FULL_LDR_DATA_TABLE_ENTRY, InMemoryOrderLinks)), |
| 212 &self_ldr_data_table_entry)) { |
| 213 return false; |
| 214 } |
| 215 if (!ReadUnicodeString( |
| 216 process, self_ldr_data_table_entry.FullDllName, &self_module)) { |
| 217 return false; |
| 218 } |
| 219 modules_.push_back(self_module); |
| 220 |
| 221 // Walk the PEB LDR structure (doubly-linked list) to get the list of loaded |
| 222 // modules. We use this method rather than EnumProcessModules to get the |
| 223 // modules in initialization order rather than memory order. |
| 224 const LIST_ENTRY* last = peb_ldr_data.InInitializationOrderModuleList.Blink; |
| 225 FULL_LDR_DATA_TABLE_ENTRY ldr_data_table_entry; |
| 226 for (const LIST_ENTRY* cur = |
| 227 peb_ldr_data.InInitializationOrderModuleList.Flink; |
| 228 ; |
| 229 cur = ldr_data_table_entry.InInitializationOrderLinks.Flink) { |
| 230 // |cur| is the pointer to the LIST_ENTRY embedded in the |
| 231 // FULL_LDR_DATA_TABLE_ENTRY, in the target process's address space. So we |
| 232 // need to read from the target, and also offset back to the beginning of |
| 233 // the structure. |
| 234 if (!ReadStruct( |
| 235 process, |
| 236 reinterpret_cast<uintptr_t>(reinterpret_cast<const char*>(cur) - |
| 237 offsetof(FULL_LDR_DATA_TABLE_ENTRY, |
| 238 InInitializationOrderLinks)), |
| 239 &ldr_data_table_entry)) { |
| 240 break; |
| 241 } |
| 242 // TODO(scottmg): Capture TimeDateStamp, Checksum, etc. too? |
| 243 std::wstring module; |
| 244 if (!ReadUnicodeString(process, ldr_data_table_entry.FullDllName, &module)) |
| 245 break; |
| 246 modules_.push_back(module); |
| 247 if (cur == last) |
| 248 break; |
| 249 } |
| 250 |
| 251 INITIALIZATION_STATE_SET_VALID(initialized_); |
| 252 return true; |
| 253 } |
| 254 |
| 255 bool ProcessInfo::Is64Bit() const { |
| 256 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 257 return is_64_bit_; |
| 258 } |
| 259 |
| 260 bool ProcessInfo::IsWow64() const { |
| 261 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 262 return is_wow64_; |
| 263 } |
| 264 |
| 265 pid_t ProcessInfo::ProcessID() const { |
| 266 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 267 return process_basic_information_.UniqueProcessId; |
| 268 } |
| 269 |
| 270 pid_t ProcessInfo::ParentProcessID() const { |
| 271 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 272 return process_basic_information_.InheritedFromUniqueProcessId; |
| 273 } |
| 274 |
| 275 bool ProcessInfo::CommandLine(std::wstring* command_line) const { |
| 276 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 277 *command_line = command_line_; |
| 278 return true; |
| 279 } |
| 280 |
| 281 bool ProcessInfo::Modules(std::vector<std::wstring>* modules) const { |
| 282 INITIALIZATION_STATE_DCHECK_VALID(initialized_); |
| 283 *modules = modules_; |
| 284 return true; |
| 285 } |
| 286 |
| 287 } // namespace crashpad |
| OLD | NEW |