OLD | NEW |
---|---|
1 // Copyright 2016 The Chromium Authors. All rights reserved. | 1 // Copyright 2016 The Chromium Authors. All rights reserved. |
2 // Use of this source code is governed by a BSD-style license that can be | 2 // Use of this source code is governed by a BSD-style license that can be |
3 // found in the LICENSE file. | 3 // found in the LICENSE file. |
4 | 4 |
5 #include "base/debug/activity_tracker.h" | 5 #include "base/debug/activity_tracker.h" |
6 | 6 |
7 #include <algorithm> | 7 #include <algorithm> |
8 #include <limits> | 8 #include <limits> |
9 #include <utility> | 9 #include <utility> |
10 | 10 |
(...skipping 12 matching lines...) Expand all Loading... | |
23 #include "base/process/process_handle.h" | 23 #include "base/process/process_handle.h" |
24 #include "base/stl_util.h" | 24 #include "base/stl_util.h" |
25 #include "base/strings/string_util.h" | 25 #include "base/strings/string_util.h" |
26 #include "base/threading/platform_thread.h" | 26 #include "base/threading/platform_thread.h" |
27 | 27 |
28 namespace base { | 28 namespace base { |
29 namespace debug { | 29 namespace debug { |
30 | 30 |
31 namespace { | 31 namespace { |
32 | 32 |
33 // A number that identifies the memory as having been initialized. It's | |
34 // arbitrary but happens to be the first 4 bytes of SHA1(ThreadActivityTracker). | |
35 // A version number is added on so that major structure changes won't try to | |
36 // read an older version (since the cookie won't match). | |
37 const uint32_t kHeaderCookie = 0xC0029B24UL + 2; // v2 | |
38 | |
39 // The minimum depth a stack should support. | 33 // The minimum depth a stack should support. |
40 const int kMinStackDepth = 2; | 34 const int kMinStackDepth = 2; |
41 | 35 |
42 // The amount of memory set aside for holding arbitrary user data (key/value | 36 // The amount of memory set aside for holding arbitrary user data (key/value |
43 // pairs) globally or associated with ActivityData entries. | 37 // pairs) globally or associated with ActivityData entries. |
44 const size_t kUserDataSize = 1 << 10; // 1 KiB | 38 const size_t kUserDataSize = 1 << 10; // 1 KiB |
39 const size_t kProcessDataSize = 4 << 10; // 4 KiB | |
45 const size_t kGlobalDataSize = 16 << 10; // 16 KiB | 40 const size_t kGlobalDataSize = 16 << 10; // 16 KiB |
46 const size_t kMaxUserDataNameLength = | 41 const size_t kMaxUserDataNameLength = |
47 static_cast<size_t>(std::numeric_limits<uint8_t>::max()); | 42 static_cast<size_t>(std::numeric_limits<uint8_t>::max()); |
48 | 43 |
49 // A constant used to indicate that module information is changing. | 44 // A constant used to indicate that module information is changing. |
50 const uint32_t kModuleInformationChanging = 0x80000000; | 45 const uint32_t kModuleInformationChanging = 0x80000000; |
51 | 46 |
47 // The key used to record process information. | |
48 const char kProcessPhaseDataKey[] = "process-phase"; | |
49 | |
50 // An atomically incrementing number, used to check for recreations of objects | |
51 // in the same memory space. | |
52 StaticAtomicSequenceNumber g_next_id; | |
53 | |
52 union ThreadRef { | 54 union ThreadRef { |
53 int64_t as_id; | 55 int64_t as_id; |
54 #if defined(OS_WIN) | 56 #if defined(OS_WIN) |
55 // On Windows, the handle itself is often a pseudo-handle with a common | 57 // On Windows, the handle itself is often a pseudo-handle with a common |
56 // value meaning "this thread" and so the thread-id is used. The former | 58 // value meaning "this thread" and so the thread-id is used. The former |
57 // can be converted to a thread-id with a system call. | 59 // can be converted to a thread-id with a system call. |
58 PlatformThreadId as_tid; | 60 PlatformThreadId as_tid; |
59 #elif defined(OS_POSIX) | 61 #elif defined(OS_POSIX) |
60 // On Posix, the handle is always a unique identifier so no conversion | 62 // On Posix, the handle is always a unique identifier so no conversion |
61 // needs to be done. However, it's value is officially opaque so there | 63 // needs to be done. However, it's value is officially opaque so there |
62 // is no one correct way to convert it to a numerical identifier. | 64 // is no one correct way to convert it to a numerical identifier. |
63 PlatformThreadHandle::Handle as_handle; | 65 PlatformThreadHandle::Handle as_handle; |
64 #endif | 66 #endif |
65 }; | 67 }; |
66 | 68 |
69 // Get the next non-zero identifier. It is only unique within a process. | |
70 uint32_t GetNextDataId() { | |
71 uint32_t id; | |
72 while ((id = g_next_id.GetNext()) == 0) | |
73 ; | |
74 return id; | |
75 } | |
76 | |
77 // Finds and reuses a specific allocation or creates a new one. | |
78 PersistentMemoryAllocator::Reference AllocateFrom( | |
79 PersistentMemoryAllocator* allocator, | |
80 uint32_t from_type, | |
81 size_t size, | |
82 uint32_t to_type) { | |
83 PersistentMemoryAllocator::Iterator iter(allocator); | |
84 PersistentMemoryAllocator::Reference ref; | |
85 while ((ref = iter.GetNextOfType(from_type)) != 0) { | |
86 DCHECK_LE(size, allocator->GetAllocSize(ref)); | |
87 // This can fail if a another thread has just taken it. It isassumed that | |
88 // the memory is cleared during the "free" operation. | |
89 if (allocator->ChangeType(ref, to_type, from_type, /*clear=*/false)) | |
90 return ref; | |
91 } | |
92 | |
93 return allocator->Allocate(size, to_type); | |
94 } | |
95 | |
67 // Determines the previous aligned index. | 96 // Determines the previous aligned index. |
68 size_t RoundDownToAlignment(size_t index, size_t alignment) { | 97 size_t RoundDownToAlignment(size_t index, size_t alignment) { |
69 return index & (0 - alignment); | 98 return index & (0 - alignment); |
70 } | 99 } |
71 | 100 |
72 // Determines the next aligned index. | 101 // Determines the next aligned index. |
73 size_t RoundUpToAlignment(size_t index, size_t alignment) { | 102 size_t RoundUpToAlignment(size_t index, size_t alignment) { |
74 return (index + (alignment - 1)) & (0 - alignment); | 103 return (index + (alignment - 1)) & (0 - alignment); |
75 } | 104 } |
76 | 105 |
77 } // namespace | 106 } // namespace |
78 | 107 |
108 ProcessInfo::ProcessInfo() {} | |
109 ProcessInfo::~ProcessInfo() {} | |
110 | |
111 void ProcessInfo::Release_Initialize() { | |
112 uint32_t old_id = data_id.load(std::memory_order_acquire); | |
113 DCHECK_EQ(0U, old_id); | |
114 process_id = GetCurrentProcId(); | |
115 create_stamp = Time::Now().ToInternalValue(); | |
116 data_id.store(GetNextDataId(), std::memory_order_release); | |
117 } | |
118 | |
119 void ProcessInfo::SetOwningProcessIdForTesting(ProcessId pid, int64_t stamp) { | |
120 process_id = pid; | |
121 create_stamp = stamp; | |
122 } | |
123 | |
124 // static | |
125 bool ProcessInfo::GetOwningProcessId(const void* memory, | |
126 ProcessId* out_id, | |
127 int64_t* out_stamp) { | |
128 const ProcessInfo* info = reinterpret_cast<const ProcessInfo*>(memory); | |
129 uint32_t id = info->data_id.load(std::memory_order_acquire); | |
130 if (id == 0) | |
131 return false; | |
132 | |
133 *out_id = static_cast<ProcessId>(info->process_id); | |
134 *out_stamp = info->create_stamp; | |
135 return id == info->data_id.load(std::memory_order_seq_cst); | |
136 } | |
79 | 137 |
80 // It doesn't matter what is contained in this (though it will be all zeros) | 138 // It doesn't matter what is contained in this (though it will be all zeros) |
81 // as only the address of it is important. | 139 // as only the address of it is important. |
82 const ActivityData kNullActivityData = {}; | 140 const ActivityData kNullActivityData = {}; |
83 | 141 |
84 ActivityData ActivityData::ForThread(const PlatformThreadHandle& handle) { | 142 ActivityData ActivityData::ForThread(const PlatformThreadHandle& handle) { |
85 ThreadRef thread_ref; | 143 ThreadRef thread_ref; |
86 thread_ref.as_id = 0; // Zero the union in case other is smaller. | 144 thread_ref.as_id = 0; // Zero the union in case other is smaller. |
87 #if defined(OS_WIN) | 145 #if defined(OS_WIN) |
88 thread_ref.as_tid = ::GetThreadId(handle.platform_handle()); | 146 thread_ref.as_tid = ::GetThreadId(handle.platform_handle()); |
(...skipping 150 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
239 StringPiece ActivityUserData::TypedValue::GetReference() const { | 297 StringPiece ActivityUserData::TypedValue::GetReference() const { |
240 DCHECK_EQ(RAW_VALUE_REFERENCE, type_); | 298 DCHECK_EQ(RAW_VALUE_REFERENCE, type_); |
241 return ref_value_; | 299 return ref_value_; |
242 } | 300 } |
243 | 301 |
244 StringPiece ActivityUserData::TypedValue::GetStringReference() const { | 302 StringPiece ActivityUserData::TypedValue::GetStringReference() const { |
245 DCHECK_EQ(STRING_VALUE_REFERENCE, type_); | 303 DCHECK_EQ(STRING_VALUE_REFERENCE, type_); |
246 return ref_value_; | 304 return ref_value_; |
247 } | 305 } |
248 | 306 |
307 // These are required because std::atomic is (currently) not a POD type and | |
308 // thus clang requires explicit out-of-line constructors and destructors even | |
309 // when they do nothing. | |
249 ActivityUserData::ValueInfo::ValueInfo() {} | 310 ActivityUserData::ValueInfo::ValueInfo() {} |
250 ActivityUserData::ValueInfo::ValueInfo(ValueInfo&&) = default; | 311 ActivityUserData::ValueInfo::ValueInfo(ValueInfo&&) = default; |
251 ActivityUserData::ValueInfo::~ValueInfo() {} | 312 ActivityUserData::ValueInfo::~ValueInfo() {} |
252 | 313 ActivityUserData::MemoryHeader::MemoryHeader() {} |
253 StaticAtomicSequenceNumber ActivityUserData::next_id_; | 314 ActivityUserData::MemoryHeader::~MemoryHeader() {} |
315 ActivityUserData::FieldHeader::FieldHeader() {} | |
316 ActivityUserData::FieldHeader::~FieldHeader() {} | |
254 | 317 |
255 ActivityUserData::ActivityUserData(void* memory, size_t size) | 318 ActivityUserData::ActivityUserData(void* memory, size_t size) |
256 : memory_(reinterpret_cast<char*>(memory)), | 319 : memory_(reinterpret_cast<char*>(memory)), |
257 available_(RoundDownToAlignment(size, kMemoryAlignment)), | 320 available_(RoundDownToAlignment(size, kMemoryAlignment)), |
258 id_(reinterpret_cast<std::atomic<uint32_t>*>(memory)) { | 321 header_(reinterpret_cast<MemoryHeader*>(memory)) { |
259 // It's possible that no user data is being stored. | 322 // It's possible that no user data is being stored. |
260 if (!memory_) | 323 if (!memory_) |
261 return; | 324 return; |
262 | 325 |
263 DCHECK_LT(kMemoryAlignment, available_); | 326 static_assert(0 == sizeof(MemoryHeader) % kMemoryAlignment, "invalid header"); |
264 if (id_->load(std::memory_order_relaxed) == 0) { | 327 DCHECK_LT(sizeof(MemoryHeader), available_); |
265 // Generate a new ID and store it in the first 32-bit word of memory_. | 328 if (header_->process_info.data_id.load(std::memory_order_acquire) == 0) |
266 // |id_| must be non-zero for non-sink instances. | 329 header_->process_info.Release_Initialize(); |
267 uint32_t id; | 330 memory_ += sizeof(MemoryHeader); |
268 while ((id = next_id_.GetNext()) == 0) | 331 available_ -= sizeof(MemoryHeader); |
269 ; | |
270 id_->store(id, std::memory_order_relaxed); | |
271 DCHECK_NE(0U, id_->load(std::memory_order_relaxed)); | |
272 } | |
273 memory_ += kMemoryAlignment; | |
274 available_ -= kMemoryAlignment; | |
275 | 332 |
276 // If there is already data present, load that. This allows the same class | 333 // If there is already data present, load that. This allows the same class |
277 // to be used for analysis through snapshots. | 334 // to be used for analysis through snapshots. |
278 ImportExistingData(); | 335 ImportExistingData(); |
279 } | 336 } |
280 | 337 |
281 ActivityUserData::~ActivityUserData() {} | 338 ActivityUserData::~ActivityUserData() {} |
282 | 339 |
340 bool ActivityUserData::CreateSnapshot(Snapshot* output_snapshot) const { | |
341 DCHECK(output_snapshot); | |
342 DCHECK(output_snapshot->empty()); | |
343 | |
344 // Find any new data that may have been added by an active instance of this | |
345 // class that is adding records. | |
346 ImportExistingData(); | |
347 | |
348 for (const auto& entry : values_) { | |
349 TypedValue value; | |
350 value.type_ = entry.second.type; | |
351 DCHECK_GE(entry.second.extent, | |
352 entry.second.size_ptr->load(std::memory_order_relaxed)); | |
353 | |
354 switch (entry.second.type) { | |
355 case RAW_VALUE: | |
356 case STRING_VALUE: | |
357 value.long_value_ = | |
358 std::string(reinterpret_cast<char*>(entry.second.memory), | |
359 entry.second.size_ptr->load(std::memory_order_relaxed)); | |
360 break; | |
361 case RAW_VALUE_REFERENCE: | |
362 case STRING_VALUE_REFERENCE: { | |
363 ReferenceRecord* ref = | |
364 reinterpret_cast<ReferenceRecord*>(entry.second.memory); | |
365 value.ref_value_ = StringPiece( | |
366 reinterpret_cast<char*>(static_cast<uintptr_t>(ref->address)), | |
367 static_cast<size_t>(ref->size)); | |
368 } break; | |
369 case BOOL_VALUE: | |
370 case CHAR_VALUE: | |
371 value.short_value_ = *reinterpret_cast<char*>(entry.second.memory); | |
372 break; | |
373 case SIGNED_VALUE: | |
374 case UNSIGNED_VALUE: | |
375 value.short_value_ = *reinterpret_cast<uint64_t*>(entry.second.memory); | |
376 break; | |
377 case END_OF_VALUES: // Included for completeness purposes. | |
378 NOTREACHED(); | |
379 } | |
380 auto inserted = output_snapshot->insert( | |
381 std::make_pair(entry.second.name.as_string(), std::move(value))); | |
382 DCHECK(inserted.second); // True if inserted, false if existed. | |
383 } | |
384 | |
385 return true; | |
386 } | |
387 | |
388 const void* ActivityUserData::GetBaseAddress() { | |
389 // The |memory_| pointer advances as elements are written but the |header_| | |
390 // value is always at the start of the block so just return that. | |
391 return header_; | |
392 } | |
393 | |
394 void ActivityUserData::SetOwningProcessIdForTesting(ProcessId pid, | |
395 int64_t stamp) { | |
396 if (!header_) | |
397 return; | |
398 header_->process_info.SetOwningProcessIdForTesting(pid, stamp); | |
399 } | |
400 | |
401 // static | |
402 bool ActivityUserData::GetOwningProcessId(const void* memory, | |
403 ProcessId* out_id, | |
404 int64_t* out_stamp) { | |
405 const MemoryHeader* header = reinterpret_cast<const MemoryHeader*>(memory); | |
406 return ProcessInfo::GetOwningProcessId(&header->process_info, out_id, | |
407 out_stamp); | |
408 } | |
409 | |
283 void ActivityUserData::Set(StringPiece name, | 410 void ActivityUserData::Set(StringPiece name, |
284 ValueType type, | 411 ValueType type, |
285 const void* memory, | 412 const void* memory, |
286 size_t size) { | 413 size_t size) { |
287 DCHECK_GE(std::numeric_limits<uint8_t>::max(), name.length()); | 414 DCHECK_GE(std::numeric_limits<uint8_t>::max(), name.length()); |
288 size = std::min(std::numeric_limits<uint16_t>::max() - (kMemoryAlignment - 1), | 415 size = std::min(std::numeric_limits<uint16_t>::max() - (kMemoryAlignment - 1), |
289 size); | 416 size); |
290 | 417 |
291 // It's possible that no user data is being stored. | 418 // It's possible that no user data is being stored. |
292 if (!memory_) | 419 if (!memory_) |
293 return; | 420 return; |
294 | 421 |
295 // The storage of a name is limited so use that limit during lookup. | 422 // The storage of a name is limited so use that limit during lookup. |
296 if (name.length() > kMaxUserDataNameLength) | 423 if (name.length() > kMaxUserDataNameLength) |
297 name.set(name.data(), kMaxUserDataNameLength); | 424 name.set(name.data(), kMaxUserDataNameLength); |
298 | 425 |
299 ValueInfo* info; | 426 ValueInfo* info; |
300 auto existing = values_.find(name); | 427 auto existing = values_.find(name); |
301 if (existing != values_.end()) { | 428 if (existing != values_.end()) { |
302 info = &existing->second; | 429 info = &existing->second; |
303 } else { | 430 } else { |
304 // The name size is limited to what can be held in a single byte but | 431 // The name size is limited to what can be held in a single byte but |
305 // because there are not alignment constraints on strings, it's set tight | 432 // because there are not alignment constraints on strings, it's set tight |
306 // against the header. Its extent (the reserved space, even if it's not | 433 // against the header. Its extent (the reserved space, even if it's not |
307 // all used) is calculated so that, when pressed against the header, the | 434 // all used) is calculated so that, when pressed against the header, the |
308 // following field will be aligned properly. | 435 // following field will be aligned properly. |
309 size_t name_size = name.length(); | 436 size_t name_size = name.length(); |
310 size_t name_extent = | 437 size_t name_extent = |
311 RoundUpToAlignment(sizeof(Header) + name_size, kMemoryAlignment) - | 438 RoundUpToAlignment(sizeof(FieldHeader) + name_size, kMemoryAlignment) - |
312 sizeof(Header); | 439 sizeof(FieldHeader); |
313 size_t value_extent = RoundUpToAlignment(size, kMemoryAlignment); | 440 size_t value_extent = RoundUpToAlignment(size, kMemoryAlignment); |
314 | 441 |
315 // The "base size" is the size of the header and (padded) string key. Stop | 442 // The "base size" is the size of the header and (padded) string key. Stop |
316 // now if there's not room enough for even this. | 443 // now if there's not room enough for even this. |
317 size_t base_size = sizeof(Header) + name_extent; | 444 size_t base_size = sizeof(FieldHeader) + name_extent; |
318 if (base_size > available_) | 445 if (base_size > available_) |
319 return; | 446 return; |
320 | 447 |
321 // The "full size" is the size for storing the entire value. | 448 // The "full size" is the size for storing the entire value. |
322 size_t full_size = std::min(base_size + value_extent, available_); | 449 size_t full_size = std::min(base_size + value_extent, available_); |
323 | 450 |
324 // If the value is actually a single byte, see if it can be stuffed at the | 451 // If the value is actually a single byte, see if it can be stuffed at the |
325 // end of the name extent rather than wasting kMemoryAlignment bytes. | 452 // end of the name extent rather than wasting kMemoryAlignment bytes. |
326 if (size == 1 && name_extent > name_size) { | 453 if (size == 1 && name_extent > name_size) { |
327 full_size = base_size; | 454 full_size = base_size; |
328 --name_extent; | 455 --name_extent; |
329 --base_size; | 456 --base_size; |
330 } | 457 } |
331 | 458 |
332 // Truncate the stored size to the amount of available memory. Stop now if | 459 // Truncate the stored size to the amount of available memory. Stop now if |
333 // there's not any room for even part of the value. | 460 // there's not any room for even part of the value. |
334 size = std::min(full_size - base_size, size); | 461 size = std::min(full_size - base_size, size); |
335 if (size == 0) | 462 if (size == 0) |
336 return; | 463 return; |
337 | 464 |
338 // Allocate a chunk of memory. | 465 // Allocate a chunk of memory. |
339 Header* header = reinterpret_cast<Header*>(memory_); | 466 FieldHeader* header = reinterpret_cast<FieldHeader*>(memory_); |
340 memory_ += full_size; | 467 memory_ += full_size; |
341 available_ -= full_size; | 468 available_ -= full_size; |
342 | 469 |
343 // Datafill the header and name records. Memory must be zeroed. The |type| | 470 // Datafill the header and name records. Memory must be zeroed. The |type| |
344 // is written last, atomically, to release all the other values. | 471 // is written last, atomically, to release all the other values. |
manzagop (departed)
2017/02/22 20:44:16
Re: the "global" activity data, I don't think this
bcwhite
2017/02/22 22:13:04
Yeah, that's a problem. And, unfortunately, it's
manzagop (departed)
2017/02/24 15:56:35
I'd say let's ignore for now. It conceptually soun
bcwhite
2017/03/06 16:33:51
Acknowledged.
| |
345 DCHECK_EQ(END_OF_VALUES, header->type.load(std::memory_order_relaxed)); | 472 DCHECK_EQ(END_OF_VALUES, header->type.load(std::memory_order_relaxed)); |
346 DCHECK_EQ(0, header->value_size.load(std::memory_order_relaxed)); | 473 DCHECK_EQ(0, header->value_size.load(std::memory_order_relaxed)); |
347 header->name_size = static_cast<uint8_t>(name_size); | 474 header->name_size = static_cast<uint8_t>(name_size); |
348 header->record_size = full_size; | 475 header->record_size = full_size; |
349 char* name_memory = reinterpret_cast<char*>(header) + sizeof(Header); | 476 char* name_memory = reinterpret_cast<char*>(header) + sizeof(FieldHeader); |
350 void* value_memory = | 477 void* value_memory = |
351 reinterpret_cast<char*>(header) + sizeof(Header) + name_extent; | 478 reinterpret_cast<char*>(header) + sizeof(FieldHeader) + name_extent; |
352 memcpy(name_memory, name.data(), name_size); | 479 memcpy(name_memory, name.data(), name_size); |
353 header->type.store(type, std::memory_order_release); | 480 header->type.store(type, std::memory_order_release); |
354 | 481 |
355 // Create an entry in |values_| so that this field can be found and changed | 482 // Create an entry in |values_| so that this field can be found and changed |
356 // later on without having to allocate new entries. | 483 // later on without having to allocate new entries. |
357 StringPiece persistent_name(name_memory, name_size); | 484 StringPiece persistent_name(name_memory, name_size); |
358 auto inserted = | 485 auto inserted = |
359 values_.insert(std::make_pair(persistent_name, ValueInfo())); | 486 values_.insert(std::make_pair(persistent_name, ValueInfo())); |
360 DCHECK(inserted.second); // True if inserted, false if existed. | 487 DCHECK(inserted.second); // True if inserted, false if existed. |
361 info = &inserted.first->second; | 488 info = &inserted.first->second; |
362 info->name = persistent_name; | 489 info->name = persistent_name; |
363 info->memory = value_memory; | 490 info->memory = value_memory; |
364 info->size_ptr = &header->value_size; | 491 info->size_ptr = &header->value_size; |
365 info->extent = full_size - sizeof(Header) - name_extent; | 492 info->extent = full_size - sizeof(FieldHeader) - name_extent; |
366 info->type = type; | 493 info->type = type; |
367 } | 494 } |
368 | 495 |
369 // Copy the value data to storage. The |size| is written last, atomically, to | 496 // Copy the value data to storage. The |size| is written last, atomically, to |
370 // release the copied data. Until then, a parallel reader will just ignore | 497 // release the copied data. Until then, a parallel reader will just ignore |
371 // records with a zero size. | 498 // records with a zero size. |
372 DCHECK_EQ(type, info->type); | 499 DCHECK_EQ(type, info->type); |
373 size = std::min(size, info->extent); | 500 size = std::min(size, info->extent); |
374 info->size_ptr->store(0, std::memory_order_seq_cst); | 501 info->size_ptr->store(0, std::memory_order_seq_cst); |
375 memcpy(info->memory, memory, size); | 502 memcpy(info->memory, memory, size); |
376 info->size_ptr->store(size, std::memory_order_release); | 503 info->size_ptr->store(size, std::memory_order_release); |
377 } | 504 } |
378 | 505 |
379 void ActivityUserData::SetReference(StringPiece name, | 506 void ActivityUserData::SetReference(StringPiece name, |
380 ValueType type, | 507 ValueType type, |
381 const void* memory, | 508 const void* memory, |
382 size_t size) { | 509 size_t size) { |
383 ReferenceRecord rec; | 510 ReferenceRecord rec; |
384 rec.address = reinterpret_cast<uintptr_t>(memory); | 511 rec.address = reinterpret_cast<uintptr_t>(memory); |
385 rec.size = size; | 512 rec.size = size; |
386 Set(name, type, &rec, sizeof(rec)); | 513 Set(name, type, &rec, sizeof(rec)); |
387 } | 514 } |
388 | 515 |
389 void ActivityUserData::ImportExistingData() const { | 516 void ActivityUserData::ImportExistingData() const { |
390 while (available_ > sizeof(Header)) { | 517 while (available_ > sizeof(FieldHeader)) { |
391 Header* header = reinterpret_cast<Header*>(memory_); | 518 FieldHeader* header = reinterpret_cast<FieldHeader*>(memory_); |
392 ValueType type = | 519 ValueType type = |
393 static_cast<ValueType>(header->type.load(std::memory_order_acquire)); | 520 static_cast<ValueType>(header->type.load(std::memory_order_acquire)); |
394 if (type == END_OF_VALUES) | 521 if (type == END_OF_VALUES) |
395 return; | 522 return; |
396 if (header->record_size > available_) | 523 if (header->record_size > available_) |
397 return; | 524 return; |
398 | 525 |
399 size_t value_offset = RoundUpToAlignment(sizeof(Header) + header->name_size, | 526 size_t value_offset = RoundUpToAlignment( |
400 kMemoryAlignment); | 527 sizeof(FieldHeader) + header->name_size, kMemoryAlignment); |
401 if (header->record_size == value_offset && | 528 if (header->record_size == value_offset && |
402 header->value_size.load(std::memory_order_relaxed) == 1) { | 529 header->value_size.load(std::memory_order_relaxed) == 1) { |
403 value_offset -= 1; | 530 value_offset -= 1; |
404 } | 531 } |
405 if (value_offset + header->value_size > header->record_size) | 532 if (value_offset + header->value_size > header->record_size) |
406 return; | 533 return; |
407 | 534 |
408 ValueInfo info; | 535 ValueInfo info; |
409 info.name = StringPiece(memory_ + sizeof(Header), header->name_size); | 536 info.name = StringPiece(memory_ + sizeof(FieldHeader), header->name_size); |
410 info.type = type; | 537 info.type = type; |
411 info.memory = memory_ + value_offset; | 538 info.memory = memory_ + value_offset; |
412 info.size_ptr = &header->value_size; | 539 info.size_ptr = &header->value_size; |
413 info.extent = header->record_size - value_offset; | 540 info.extent = header->record_size - value_offset; |
414 | 541 |
415 StringPiece key(info.name); | 542 StringPiece key(info.name); |
416 values_.insert(std::make_pair(key, std::move(info))); | 543 values_.insert(std::make_pair(key, std::move(info))); |
417 | 544 |
418 memory_ += header->record_size; | 545 memory_ += header->record_size; |
419 available_ -= header->record_size; | 546 available_ -= header->record_size; |
420 } | 547 } |
421 } | 548 } |
422 | 549 |
423 bool ActivityUserData::CreateSnapshot(Snapshot* output_snapshot) const { | |
424 DCHECK(output_snapshot); | |
425 DCHECK(output_snapshot->empty()); | |
426 | |
427 // Find any new data that may have been added by an active instance of this | |
428 // class that is adding records. | |
429 ImportExistingData(); | |
430 | |
431 for (const auto& entry : values_) { | |
432 TypedValue value; | |
433 value.type_ = entry.second.type; | |
434 DCHECK_GE(entry.second.extent, | |
435 entry.second.size_ptr->load(std::memory_order_relaxed)); | |
436 | |
437 switch (entry.second.type) { | |
438 case RAW_VALUE: | |
439 case STRING_VALUE: | |
440 value.long_value_ = | |
441 std::string(reinterpret_cast<char*>(entry.second.memory), | |
442 entry.second.size_ptr->load(std::memory_order_relaxed)); | |
443 break; | |
444 case RAW_VALUE_REFERENCE: | |
445 case STRING_VALUE_REFERENCE: { | |
446 ReferenceRecord* ref = | |
447 reinterpret_cast<ReferenceRecord*>(entry.second.memory); | |
448 value.ref_value_ = StringPiece( | |
449 reinterpret_cast<char*>(static_cast<uintptr_t>(ref->address)), | |
450 static_cast<size_t>(ref->size)); | |
451 } break; | |
452 case BOOL_VALUE: | |
453 case CHAR_VALUE: | |
454 value.short_value_ = *reinterpret_cast<char*>(entry.second.memory); | |
455 break; | |
456 case SIGNED_VALUE: | |
457 case UNSIGNED_VALUE: | |
458 value.short_value_ = *reinterpret_cast<uint64_t*>(entry.second.memory); | |
459 break; | |
460 case END_OF_VALUES: // Included for completeness purposes. | |
461 NOTREACHED(); | |
462 } | |
463 auto inserted = output_snapshot->insert( | |
464 std::make_pair(entry.second.name.as_string(), std::move(value))); | |
465 DCHECK(inserted.second); // True if inserted, false if existed. | |
466 } | |
467 | |
468 return true; | |
469 } | |
470 | |
471 const void* ActivityUserData::GetBaseAddress() { | |
472 // The |memory_| pointer advances as elements are written but the |id_| | |
473 // value is always at the start of the block so just return that. | |
474 return id_; | |
475 } | |
476 | |
477 // This information is kept for every thread that is tracked. It is filled | 550 // This information is kept for every thread that is tracked. It is filled |
478 // the very first time the thread is seen. All fields must be of exact sizes | 551 // the very first time the thread is seen. All fields must be of exact sizes |
479 // so there is no issue moving between 32 and 64-bit builds. | 552 // so there is no issue moving between 32 and 64-bit builds. |
480 struct ThreadActivityTracker::Header { | 553 struct ThreadActivityTracker::Header { |
481 // Defined in .h for analyzer access. Increment this if structure changes! | 554 // Defined in .h for analyzer access. Increment this if structure changes! |
482 static constexpr uint32_t kPersistentTypeId = | 555 static constexpr uint32_t kPersistentTypeId = |
483 GlobalActivityTracker::kTypeIdActivityTracker; | 556 GlobalActivityTracker::kTypeIdActivityTracker; |
484 | 557 |
485 // Expected size for 32/64-bit check. | 558 // Expected size for 32/64-bit check. |
486 static constexpr size_t kExpectedInstanceSize = 80; | 559 static constexpr size_t kExpectedInstanceSize = |
560 ProcessInfo::kExpectedInstanceSize + 72; | |
487 | 561 |
488 // This unique number indicates a valid initialization of the memory. | 562 // This information uniquely identifies a process. |
489 std::atomic<uint32_t> cookie; | 563 ProcessInfo process_info; |
490 | 564 |
491 // The number of Activity slots (spaces that can hold an Activity) that | 565 // The thread-id (thread_ref.as_id) to which this data belongs. This number |
492 // immediately follow this structure in memory. | 566 // is not guaranteed to mean anything but combined with the process-id from |
493 uint32_t stack_slots; | 567 // ProcessInfo is unique among all active trackers. |
494 | |
495 // The process-id and thread-id (thread_ref.as_id) to which this data belongs. | |
496 // These identifiers are not guaranteed to mean anything but are unique, in | |
497 // combination, among all active trackers. It would be nice to always have | |
498 // the process_id be a 64-bit value but the necessity of having it atomic | |
499 // (for the memory barriers it provides) limits it to the natural word size | |
500 // of the machine. | |
501 #ifdef ARCH_CPU_64_BITS | |
502 std::atomic<int64_t> process_id; | |
503 #else | |
504 std::atomic<int32_t> process_id; | |
505 int32_t process_id_padding; | |
506 #endif | |
507 ThreadRef thread_ref; | 568 ThreadRef thread_ref; |
508 | 569 |
509 // The start-time and start-ticks when the data was created. Each activity | 570 // The start-time and start-ticks when the data was created. Each activity |
510 // record has a |time_internal| value that can be converted to a "wall time" | 571 // record has a |time_internal| value that can be converted to a "wall time" |
511 // with these two values. | 572 // with these two values. |
512 int64_t start_time; | 573 int64_t start_time; |
513 int64_t start_ticks; | 574 int64_t start_ticks; |
514 | 575 |
576 // The number of Activity slots (spaces that can hold an Activity) that | |
577 // immediately follow this structure in memory. | |
578 uint32_t stack_slots; | |
579 | |
580 // Some padding to keep everything 64-bit aligned. | |
581 uint32_t padding; | |
582 | |
515 // The current depth of the stack. This may be greater than the number of | 583 // The current depth of the stack. This may be greater than the number of |
516 // slots. If the depth exceeds the number of slots, the newest entries | 584 // slots. If the depth exceeds the number of slots, the newest entries |
517 // won't be recorded. | 585 // won't be recorded. |
518 std::atomic<uint32_t> current_depth; | 586 std::atomic<uint32_t> current_depth; |
519 | 587 |
520 // A memory location used to indicate if changes have been made to the stack | 588 // A memory location used to indicate if changes have been made to the stack |
521 // that would invalidate an in-progress read of its contents. The active | 589 // that would invalidate an in-progress read of its contents. The active |
522 // tracker will zero the value whenever something gets popped from the | 590 // tracker will zero the value whenever something gets popped from the |
523 // stack. A monitoring tracker can write a non-zero value here, copy the | 591 // stack. A monitoring tracker can write a non-zero value here, copy the |
524 // stack contents, and read the value to know, if it is still non-zero, that | 592 // stack contents, and read the value to know, if it is still non-zero, that |
(...skipping 62 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
587 sizeof(header_->thread_ref) == sizeof(header_->thread_ref.as_id), | 655 sizeof(header_->thread_ref) == sizeof(header_->thread_ref.as_id), |
588 "PlatformThreadHandle::Handle is too big to hold in 64-bit ID"); | 656 "PlatformThreadHandle::Handle is too big to hold in 64-bit ID"); |
589 | 657 |
590 // Ensure that the alignment of Activity.data is properly aligned to a | 658 // Ensure that the alignment of Activity.data is properly aligned to a |
591 // 64-bit boundary so there are no interoperability-issues across cpu | 659 // 64-bit boundary so there are no interoperability-issues across cpu |
592 // architectures. | 660 // architectures. |
593 static_assert(offsetof(Activity, data) % sizeof(uint64_t) == 0, | 661 static_assert(offsetof(Activity, data) % sizeof(uint64_t) == 0, |
594 "ActivityData.data is not 64-bit aligned"); | 662 "ActivityData.data is not 64-bit aligned"); |
595 | 663 |
596 // Provided memory should either be completely initialized or all zeros. | 664 // Provided memory should either be completely initialized or all zeros. |
597 if (header_->cookie.load(std::memory_order_relaxed) == 0) { | 665 if (header_->process_info.data_id.load(std::memory_order_relaxed) == 0) { |
598 // This is a new file. Double-check other fields and then initialize. | 666 // This is a new file. Double-check other fields and then initialize. |
599 DCHECK_EQ(0, header_->process_id.load(std::memory_order_relaxed)); | 667 DCHECK_EQ(0, header_->process_info.process_id); |
668 DCHECK_EQ(0, header_->process_info.create_stamp); | |
600 DCHECK_EQ(0, header_->thread_ref.as_id); | 669 DCHECK_EQ(0, header_->thread_ref.as_id); |
601 DCHECK_EQ(0, header_->start_time); | 670 DCHECK_EQ(0, header_->start_time); |
602 DCHECK_EQ(0, header_->start_ticks); | 671 DCHECK_EQ(0, header_->start_ticks); |
603 DCHECK_EQ(0U, header_->stack_slots); | 672 DCHECK_EQ(0U, header_->stack_slots); |
604 DCHECK_EQ(0U, header_->current_depth.load(std::memory_order_relaxed)); | 673 DCHECK_EQ(0U, header_->current_depth.load(std::memory_order_relaxed)); |
605 DCHECK_EQ(0U, header_->stack_unchanged.load(std::memory_order_relaxed)); | 674 DCHECK_EQ(0U, header_->stack_unchanged.load(std::memory_order_relaxed)); |
606 DCHECK_EQ(0, stack_[0].time_internal); | 675 DCHECK_EQ(0, stack_[0].time_internal); |
607 DCHECK_EQ(0U, stack_[0].origin_address); | 676 DCHECK_EQ(0U, stack_[0].origin_address); |
608 DCHECK_EQ(0U, stack_[0].call_stack[0]); | 677 DCHECK_EQ(0U, stack_[0].call_stack[0]); |
609 DCHECK_EQ(0U, stack_[0].data.task.sequence_id); | 678 DCHECK_EQ(0U, stack_[0].data.task.sequence_id); |
610 | 679 |
611 #if defined(OS_WIN) | 680 #if defined(OS_WIN) |
612 header_->thread_ref.as_tid = PlatformThread::CurrentId(); | 681 header_->thread_ref.as_tid = PlatformThread::CurrentId(); |
613 #elif defined(OS_POSIX) | 682 #elif defined(OS_POSIX) |
614 header_->thread_ref.as_handle = | 683 header_->thread_ref.as_handle = |
615 PlatformThread::CurrentHandle().platform_handle(); | 684 PlatformThread::CurrentHandle().platform_handle(); |
616 #endif | 685 #endif |
617 header_->process_id.store(GetCurrentProcId(), std::memory_order_relaxed); | |
618 | 686 |
619 header_->start_time = base::Time::Now().ToInternalValue(); | 687 header_->start_time = base::Time::Now().ToInternalValue(); |
620 header_->start_ticks = base::TimeTicks::Now().ToInternalValue(); | 688 header_->start_ticks = base::TimeTicks::Now().ToInternalValue(); |
621 header_->stack_slots = stack_slots_; | 689 header_->stack_slots = stack_slots_; |
622 strlcpy(header_->thread_name, PlatformThread::GetName(), | 690 strlcpy(header_->thread_name, PlatformThread::GetName(), |
623 sizeof(header_->thread_name)); | 691 sizeof(header_->thread_name)); |
624 | 692 |
625 // This is done last so as to guarantee that everything above is "released" | 693 // This is done last so as to guarantee that everything above is "released" |
626 // by the time this value gets written. | 694 // by the time this value gets written. |
627 header_->cookie.store(kHeaderCookie, std::memory_order_release); | 695 header_->process_info.Release_Initialize(); |
628 | 696 |
629 valid_ = true; | 697 valid_ = true; |
630 DCHECK(IsValid()); | 698 DCHECK(IsValid()); |
631 } else { | 699 } else { |
632 // This is a file with existing data. Perform basic consistency checks. | 700 // This is a file with existing data. Perform basic consistency checks. |
633 valid_ = true; | 701 valid_ = true; |
634 valid_ = IsValid(); | 702 valid_ = IsValid(); |
635 } | 703 } |
636 } | 704 } |
637 | 705 |
(...skipping 124 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
762 ActivityId id, | 830 ActivityId id, |
763 ActivityTrackerMemoryAllocator* allocator) { | 831 ActivityTrackerMemoryAllocator* allocator) { |
764 // User-data is only stored for activities actually held in the stack. | 832 // User-data is only stored for activities actually held in the stack. |
765 if (id < stack_slots_ && stack_[id].user_data_ref) { | 833 if (id < stack_slots_ && stack_[id].user_data_ref) { |
766 allocator->ReleaseObjectReference(stack_[id].user_data_ref); | 834 allocator->ReleaseObjectReference(stack_[id].user_data_ref); |
767 stack_[id].user_data_ref = 0; | 835 stack_[id].user_data_ref = 0; |
768 } | 836 } |
769 } | 837 } |
770 | 838 |
771 bool ThreadActivityTracker::IsValid() const { | 839 bool ThreadActivityTracker::IsValid() const { |
772 if (header_->cookie.load(std::memory_order_acquire) != kHeaderCookie || | 840 if (header_->process_info.data_id.load(std::memory_order_acquire) == 0 || |
773 header_->process_id.load(std::memory_order_relaxed) == 0 || | 841 header_->process_info.process_id == 0 || header_->thread_ref.as_id == 0 || |
774 header_->thread_ref.as_id == 0 || | 842 header_->start_time == 0 || header_->start_ticks == 0 || |
775 header_->start_time == 0 || | |
776 header_->start_ticks == 0 || | |
777 header_->stack_slots != stack_slots_ || | 843 header_->stack_slots != stack_slots_ || |
778 header_->thread_name[sizeof(header_->thread_name) - 1] != '\0') { | 844 header_->thread_name[sizeof(header_->thread_name) - 1] != '\0') { |
779 return false; | 845 return false; |
780 } | 846 } |
781 | 847 |
782 return valid_; | 848 return valid_; |
783 } | 849 } |
784 | 850 |
785 bool ThreadActivityTracker::CreateSnapshot(Snapshot* output_snapshot) const { | 851 bool ThreadActivityTracker::CreateSnapshot(Snapshot* output_snapshot) const { |
786 DCHECK(output_snapshot); | 852 DCHECK(output_snapshot); |
(...skipping 10 matching lines...) Expand all Loading... | |
797 // Stop here if the data isn't valid. | 863 // Stop here if the data isn't valid. |
798 if (!IsValid()) | 864 if (!IsValid()) |
799 return false; | 865 return false; |
800 | 866 |
801 // Allocate the maximum size for the stack so it doesn't have to be done | 867 // Allocate the maximum size for the stack so it doesn't have to be done |
802 // during the time-sensitive snapshot operation. It is shrunk once the | 868 // during the time-sensitive snapshot operation. It is shrunk once the |
803 // actual size is known. | 869 // actual size is known. |
804 output_snapshot->activity_stack.reserve(stack_slots_); | 870 output_snapshot->activity_stack.reserve(stack_slots_); |
805 | 871 |
806 for (int attempt = 0; attempt < kMaxAttempts; ++attempt) { | 872 for (int attempt = 0; attempt < kMaxAttempts; ++attempt) { |
807 // Remember the process and thread IDs to ensure they aren't replaced | 873 // Remember the data IDs to ensure nothing is replaced during the snapshot |
808 // during the snapshot operation. Use "acquire" to ensure that all the | 874 // operation. Use "acquire" so that all the non-atomic fields of the |
809 // non-atomic fields of the structure are valid (at least at the current | 875 // structure are valid (at least at the current moment in time). |
810 // moment in time). | 876 const uint32_t starting_id = |
811 const int64_t starting_process_id = | 877 header_->process_info.data_id.load(std::memory_order_acquire); |
812 header_->process_id.load(std::memory_order_acquire); | 878 const int64_t starting_process_id = header_->process_info.process_id; |
813 const int64_t starting_thread_id = header_->thread_ref.as_id; | 879 const int64_t starting_thread_id = header_->thread_ref.as_id; |
814 | 880 |
815 // Write a non-zero value to |stack_unchanged| so it's possible to detect | 881 // Write a non-zero value to |stack_unchanged| so it's possible to detect |
816 // at the end that nothing has changed since copying the data began. A | 882 // at the end that nothing has changed since copying the data began. A |
817 // "cst" operation is required to ensure it occurs before everything else. | 883 // "cst" operation is required to ensure it occurs before everything else. |
818 // Using "cst" memory ordering is relatively expensive but this is only | 884 // Using "cst" memory ordering is relatively expensive but this is only |
819 // done during analysis so doesn't directly affect the worker threads. | 885 // done during analysis so doesn't directly affect the worker threads. |
820 header_->stack_unchanged.store(1, std::memory_order_seq_cst); | 886 header_->stack_unchanged.store(1, std::memory_order_seq_cst); |
821 | 887 |
822 // Fetching the current depth also "acquires" the contents of the stack. | 888 // Fetching the current depth also "acquires" the contents of the stack. |
823 depth = header_->current_depth.load(std::memory_order_acquire); | 889 depth = header_->current_depth.load(std::memory_order_acquire); |
824 uint32_t count = std::min(depth, stack_slots_); | 890 uint32_t count = std::min(depth, stack_slots_); |
825 output_snapshot->activity_stack.resize(count); | 891 output_snapshot->activity_stack.resize(count); |
826 if (count > 0) { | 892 if (count > 0) { |
827 // Copy the existing contents. Memcpy is used for speed. | 893 // Copy the existing contents. Memcpy is used for speed. |
828 memcpy(&output_snapshot->activity_stack[0], stack_, | 894 memcpy(&output_snapshot->activity_stack[0], stack_, |
829 count * sizeof(Activity)); | 895 count * sizeof(Activity)); |
830 } | 896 } |
831 | 897 |
832 // Retry if something changed during the copy. A "cst" operation ensures | 898 // Retry if something changed during the copy. A "cst" operation ensures |
833 // it must happen after all the above operations. | 899 // it must happen after all the above operations. |
834 if (!header_->stack_unchanged.load(std::memory_order_seq_cst)) | 900 if (!header_->stack_unchanged.load(std::memory_order_seq_cst)) |
835 continue; | 901 continue; |
836 | 902 |
837 // Stack copied. Record it's full depth. | 903 // Stack copied. Record it's full depth. |
838 output_snapshot->activity_stack_depth = depth; | 904 output_snapshot->activity_stack_depth = depth; |
839 | 905 |
840 // TODO(bcwhite): Snapshot other things here. | 906 // TODO(bcwhite): Snapshot other things here. |
841 | 907 |
842 // Get the general thread information. Loading of "process_id" is guaranteed | 908 // Get the general thread information. Loading of "process_id" is guaranteed |
manzagop (departed)
2017/02/22 20:44:16
Update comment about motivation for process_id bei
bcwhite
2017/02/22 22:13:04
Done.
| |
843 // to be last so that it's possible to detect below if any content has | 909 // to be last so that it's possible to detect below if any content has |
844 // changed while reading it. It's technically possible for a thread to end, | 910 // changed while reading it. It's technically possible for a thread to end, |
845 // have its data cleared, a new thread get created with the same IDs, and | 911 // have its data cleared, a new thread get created with the same IDs, and |
846 // it perform an action which starts tracking all in the time since the | 912 // it perform an action which starts tracking all in the time since the |
847 // ID reads above but the chance is so unlikely that it's not worth the | 913 // ID reads above but the chance is so unlikely that it's not worth the |
848 // effort and complexity of protecting against it (perhaps with an | 914 // effort and complexity of protecting against it (perhaps with an |
849 // "unchanged" field like is done for the stack). | 915 // "unchanged" field like is done for the stack). |
850 output_snapshot->thread_name = | 916 output_snapshot->thread_name = |
851 std::string(header_->thread_name, sizeof(header_->thread_name) - 1); | 917 std::string(header_->thread_name, sizeof(header_->thread_name) - 1); |
852 output_snapshot->thread_id = header_->thread_ref.as_id; | 918 output_snapshot->thread_id = header_->thread_ref.as_id; |
853 output_snapshot->process_id = | 919 output_snapshot->process_id = header_->process_info.process_id; |
854 header_->process_id.load(std::memory_order_seq_cst); | |
855 | 920 |
856 // All characters of the thread-name buffer were copied so as to not break | 921 // All characters of the thread-name buffer were copied so as to not break |
857 // if the trailing NUL were missing. Now limit the length if the actual | 922 // if the trailing NUL were missing. Now limit the length if the actual |
858 // name is shorter. | 923 // name is shorter. |
859 output_snapshot->thread_name.resize( | 924 output_snapshot->thread_name.resize( |
860 strlen(output_snapshot->thread_name.c_str())); | 925 strlen(output_snapshot->thread_name.c_str())); |
861 | 926 |
862 // If the process or thread ID has changed then the tracker has exited and | 927 // If the data ID has changed then the tracker has exited and the memory |
manzagop (departed)
2017/02/22 20:44:16
Same question about the freeing operation: do we n
bcwhite
2017/02/22 22:13:04
Acknowledged.
| |
863 // the memory reused by a new one. Try again. | 928 // reused by a new one. Try again. |
864 if (output_snapshot->process_id != starting_process_id || | 929 if (header_->process_info.data_id.load(std::memory_order_seq_cst) != |
930 starting_id || | |
931 output_snapshot->process_id != starting_process_id || | |
865 output_snapshot->thread_id != starting_thread_id) { | 932 output_snapshot->thread_id != starting_thread_id) { |
866 continue; | 933 continue; |
867 } | 934 } |
868 | 935 |
869 // Only successful if the data is still valid once everything is done since | 936 // Only successful if the data is still valid once everything is done since |
870 // it's possible for the thread to end somewhere in the middle and all its | 937 // it's possible for the thread to end somewhere in the middle and all its |
871 // values become garbage. | 938 // values become garbage. |
872 if (!IsValid()) | 939 if (!IsValid()) |
873 return false; | 940 return false; |
874 | 941 |
875 // Change all the timestamps in the activities from "ticks" to "wall" time. | 942 // Change all the timestamps in the activities from "ticks" to "wall" time. |
876 const Time start_time = Time::FromInternalValue(header_->start_time); | 943 const Time start_time = Time::FromInternalValue(header_->start_time); |
877 const int64_t start_ticks = header_->start_ticks; | 944 const int64_t start_ticks = header_->start_ticks; |
878 for (Activity& activity : output_snapshot->activity_stack) { | 945 for (Activity& activity : output_snapshot->activity_stack) { |
879 activity.time_internal = | 946 activity.time_internal = |
880 (start_time + | 947 (start_time + |
881 TimeDelta::FromInternalValue(activity.time_internal - start_ticks)) | 948 TimeDelta::FromInternalValue(activity.time_internal - start_ticks)) |
882 .ToInternalValue(); | 949 .ToInternalValue(); |
883 } | 950 } |
884 | 951 |
885 // Success! | 952 // Success! |
886 return true; | 953 return true; |
887 } | 954 } |
888 | 955 |
889 // Too many attempts. | 956 // Too many attempts. |
890 return false; | 957 return false; |
891 } | 958 } |
892 | 959 |
960 const void* ThreadActivityTracker::GetBaseAddress() { | |
961 return header_; | |
962 } | |
963 | |
964 void ThreadActivityTracker::SetOwningProcessIdForTesting(ProcessId pid, | |
965 int64_t stamp) { | |
966 header_->process_info.SetOwningProcessIdForTesting(pid, stamp); | |
967 } | |
968 | |
969 // static | |
970 bool ThreadActivityTracker::GetOwningProcessId(const void* memory, | |
971 ProcessId* out_id, | |
972 int64_t* out_stamp) { | |
973 const Header* header = reinterpret_cast<const Header*>(memory); | |
974 return ProcessInfo::GetOwningProcessId(&header->process_info, out_id, | |
975 out_stamp); | |
976 } | |
977 | |
893 // static | 978 // static |
894 size_t ThreadActivityTracker::SizeForStackDepth(int stack_depth) { | 979 size_t ThreadActivityTracker::SizeForStackDepth(int stack_depth) { |
895 return static_cast<size_t>(stack_depth) * sizeof(Activity) + sizeof(Header); | 980 return static_cast<size_t>(stack_depth) * sizeof(Activity) + sizeof(Header); |
896 } | 981 } |
897 | 982 |
898 // The instantiation of the GlobalActivityTracker object. | 983 // The instantiation of the GlobalActivityTracker object. |
899 // The object held here will obviously not be destructed at process exit | 984 // The object held here will obviously not be destructed at process exit |
900 // but that's best since PersistentMemoryAllocator objects (that underlie | 985 // but that's best since PersistentMemoryAllocator objects (that underlie |
901 // GlobalActivityTracker objects) are explicitly forbidden from doing anything | 986 // GlobalActivityTracker objects) are explicitly forbidden from doing anything |
902 // essential at exit anyway due to the fact that they depend on data managed | 987 // essential at exit anyway due to the fact that they depend on data managed |
(...skipping 67 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
970 // These fields never changes and are done before the record is made | 1055 // These fields never changes and are done before the record is made |
971 // iterable so no thread protection is necessary. | 1056 // iterable so no thread protection is necessary. |
972 size = info.size; | 1057 size = info.size; |
973 timestamp = info.timestamp; | 1058 timestamp = info.timestamp; |
974 age = info.age; | 1059 age = info.age; |
975 memcpy(identifier, info.identifier, sizeof(identifier)); | 1060 memcpy(identifier, info.identifier, sizeof(identifier)); |
976 memcpy(pickle, pickler.data(), pickler.size()); | 1061 memcpy(pickle, pickler.data(), pickler.size()); |
977 pickle_size = pickler.size(); | 1062 pickle_size = pickler.size(); |
978 changes.store(0, std::memory_order_relaxed); | 1063 changes.store(0, std::memory_order_relaxed); |
979 | 1064 |
1065 // Initialize the process info. | |
1066 process_info.Release_Initialize(); | |
1067 | |
980 // Now set those fields that can change. | 1068 // Now set those fields that can change. |
981 return UpdateFrom(info); | 1069 return UpdateFrom(info); |
982 } | 1070 } |
983 | 1071 |
984 bool GlobalActivityTracker::ModuleInfoRecord::UpdateFrom( | 1072 bool GlobalActivityTracker::ModuleInfoRecord::UpdateFrom( |
985 const GlobalActivityTracker::ModuleInfo& info) { | 1073 const GlobalActivityTracker::ModuleInfo& info) { |
986 // Updates can occur after the record is made visible so make changes atomic. | 1074 // Updates can occur after the record is made visible so make changes atomic. |
987 // A "strong" exchange ensures no false failures. | 1075 // A "strong" exchange ensures no false failures. |
988 uint32_t old_changes = changes.load(std::memory_order_relaxed); | 1076 uint32_t old_changes = changes.load(std::memory_order_relaxed); |
989 uint32_t new_changes = old_changes | kModuleInformationChanging; | 1077 uint32_t new_changes = old_changes | kModuleInformationChanging; |
(...skipping 54 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
1044 AutoLock lock(global->user_data_allocator_lock_); | 1132 AutoLock lock(global->user_data_allocator_lock_); |
1045 user_data_ = | 1133 user_data_ = |
1046 tracker_->GetUserData(activity_id_, &global->user_data_allocator_); | 1134 tracker_->GetUserData(activity_id_, &global->user_data_allocator_); |
1047 } else { | 1135 } else { |
1048 user_data_ = MakeUnique<ActivityUserData>(nullptr, 0); | 1136 user_data_ = MakeUnique<ActivityUserData>(nullptr, 0); |
1049 } | 1137 } |
1050 } | 1138 } |
1051 return *user_data_; | 1139 return *user_data_; |
1052 } | 1140 } |
1053 | 1141 |
1054 GlobalActivityTracker::GlobalUserData::GlobalUserData(void* memory, size_t size) | 1142 GlobalActivityTracker::ThreadSafeUserData::ThreadSafeUserData(void* memory, |
1143 size_t size) | |
1055 : ActivityUserData(memory, size) {} | 1144 : ActivityUserData(memory, size) {} |
1056 | 1145 |
1057 GlobalActivityTracker::GlobalUserData::~GlobalUserData() {} | 1146 GlobalActivityTracker::ThreadSafeUserData::~ThreadSafeUserData() {} |
1058 | 1147 |
1059 void GlobalActivityTracker::GlobalUserData::Set(StringPiece name, | 1148 void GlobalActivityTracker::ThreadSafeUserData::Set(StringPiece name, |
1060 ValueType type, | 1149 ValueType type, |
1061 const void* memory, | 1150 const void* memory, |
1062 size_t size) { | 1151 size_t size) { |
1063 AutoLock lock(data_lock_); | 1152 AutoLock lock(data_lock_); |
1064 ActivityUserData::Set(name, type, memory, size); | 1153 ActivityUserData::Set(name, type, memory, size); |
1065 } | 1154 } |
1066 | 1155 |
1067 GlobalActivityTracker::ManagedActivityTracker::ManagedActivityTracker( | 1156 GlobalActivityTracker::ManagedActivityTracker::ManagedActivityTracker( |
1068 PersistentMemoryAllocator::Reference mem_reference, | 1157 PersistentMemoryAllocator::Reference mem_reference, |
1069 void* base, | 1158 void* base, |
1070 size_t size) | 1159 size_t size) |
1071 : ThreadActivityTracker(base, size), | 1160 : ThreadActivityTracker(base, size), |
1072 mem_reference_(mem_reference), | 1161 mem_reference_(mem_reference), |
(...skipping 104 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
1177 return tracker; | 1266 return tracker; |
1178 } | 1267 } |
1179 | 1268 |
1180 void GlobalActivityTracker::ReleaseTrackerForCurrentThreadForTesting() { | 1269 void GlobalActivityTracker::ReleaseTrackerForCurrentThreadForTesting() { |
1181 ThreadActivityTracker* tracker = | 1270 ThreadActivityTracker* tracker = |
1182 reinterpret_cast<ThreadActivityTracker*>(this_thread_tracker_.Get()); | 1271 reinterpret_cast<ThreadActivityTracker*>(this_thread_tracker_.Get()); |
1183 if (tracker) | 1272 if (tracker) |
1184 delete tracker; | 1273 delete tracker; |
1185 } | 1274 } |
1186 | 1275 |
1276 void GlobalActivityTracker::SetBackgroundTaskRunner( | |
1277 const scoped_refptr<TaskRunner>& runner) { | |
1278 AutoLock lock(global_tracker_lock_); | |
1279 background_task_runner_ = runner; | |
1280 } | |
1281 | |
1282 void GlobalActivityTracker::SetProcessExitCallback( | |
1283 ProcessExitCallback callback) { | |
1284 AutoLock lock(global_tracker_lock_); | |
1285 process_exit_callback_ = callback; | |
1286 } | |
1287 | |
1288 void GlobalActivityTracker::RecordProcessLaunch(ProcessId process_id) { | |
1289 DCHECK_NE(GetCurrentProcId(), process_id); | |
1290 | |
1291 base::AutoLock lock(global_tracker_lock_); | |
1292 DCHECK(!base::ContainsKey(known_processes_, process_id)); | |
1293 known_processes_.insert(process_id); | |
1294 } | |
1295 | |
1296 void GlobalActivityTracker::RecordProcessExit(ProcessId process_id, | |
1297 int exit_code) { | |
1298 DCHECK_NE(GetCurrentProcId(), process_id); | |
1299 | |
1300 scoped_refptr<TaskRunner> task_runner; | |
1301 { | |
1302 base::AutoLock lock(global_tracker_lock_); | |
1303 task_runner = background_task_runner_; | |
1304 auto found = known_processes_.find(process_id); | |
1305 if (found != known_processes_.end()) | |
1306 known_processes_.erase(found); | |
1307 else | |
1308 DLOG(ERROR) << "Recording exit of unknown process #" << process_id; | |
1309 } | |
1310 | |
1311 int64_t now_stamp = Time::Now().ToInternalValue(); | |
1312 | |
1313 // The persistent allocator is thread-safe so run the iteration and | |
1314 // adjustments on a worker thread if one was provided. | |
1315 if (task_runner && !task_runner->RunsTasksOnCurrentThread()) { | |
1316 task_runner->PostTask( | |
1317 FROM_HERE, Bind(&GlobalActivityTracker::CleanupAfterProcess, | |
1318 Unretained(this), process_id, now_stamp, exit_code)); | |
1319 return; | |
1320 } | |
1321 | |
1322 CleanupAfterProcess(process_id, now_stamp, exit_code); | |
manzagop (departed)
2017/02/22 20:44:15
Same as other comment, pid recycling may be an iss
bcwhite
2017/02/22 22:13:04
In this case, any new process will have a "create_
| |
1323 } | |
1324 | |
1325 void GlobalActivityTracker::SetProcessPhase(ProcessPhase phase) { | |
1326 process_data().SetInt(kProcessPhaseDataKey, phase); | |
1327 } | |
1328 | |
1329 void GlobalActivityTracker::CleanupAfterProcess(ProcessId process_id, | |
1330 int64_t exit_stamp, | |
1331 int exit_code) { | |
1332 // The process may not have exited cleanly so its necessary to go through | |
1333 // all the data structures it may have allocated in the persistent memory | |
1334 // segment and mark them as "released". This will allow them to be reused | |
1335 // later on. | |
1336 | |
1337 PersistentMemoryAllocator::Iterator iter(allocator_.get()); | |
1338 PersistentMemoryAllocator::Reference ref; | |
1339 | |
1340 ProcessExitCallback process_exit_callback; | |
1341 { | |
1342 AutoLock lock(global_tracker_lock_); | |
1343 process_exit_callback = process_exit_callback_; | |
1344 } | |
1345 if (process_exit_callback) { | |
1346 // Find the processes user-data record so the process phase can be passed | |
1347 // to the callback. | |
1348 ActivityUserData::Snapshot process_data_snapshot; | |
1349 while ((ref = iter.GetNextOfType(kTypeIdProcessDataRecord)) != 0) { | |
1350 const void* memory = allocator_->GetAsArray<char>( | |
1351 ref, kTypeIdProcessDataRecord, PersistentMemoryAllocator::kSizeAny); | |
1352 ProcessId found_id; | |
1353 int64_t create_stamp; | |
1354 if (ActivityUserData::GetOwningProcessId(memory, &found_id, | |
1355 &create_stamp)) { | |
1356 if (found_id == process_id && create_stamp < exit_stamp) { | |
1357 const ActivityUserData process_data(const_cast<void*>(memory), | |
1358 allocator_->GetAllocSize(ref)); | |
1359 process_data.CreateSnapshot(&process_data_snapshot); | |
1360 break; // No need to look for any others. | |
1361 } | |
1362 } | |
1363 } | |
1364 iter.Reset(); // So it starts anew when used below. | |
1365 | |
1366 // Record the process's phase at exit so callback doesn't need to go | |
1367 // searching | |
1368 // based on a private key value. | |
1369 ProcessPhase exit_phase = PROCESS_PHASE_UNKNOWN; | |
1370 auto phase = process_data_snapshot.find(kProcessPhaseDataKey); | |
1371 if (phase != process_data_snapshot.end()) | |
1372 exit_phase = static_cast<ProcessPhase>(phase->second.GetInt()); | |
1373 | |
1374 // Perform the callback. | |
1375 process_exit_callback.Run(process_id, exit_stamp, exit_code, exit_phase, | |
1376 std::move(process_data_snapshot)); | |
1377 } | |
1378 | |
1379 // Find all allocations associated with the exited process and free them. | |
1380 uint32_t type; | |
1381 while ((ref = iter.GetNext(&type)) != 0) { | |
1382 switch (type) { | |
1383 case kTypeIdActivityTracker: | |
1384 case kTypeIdUserDataRecord: | |
1385 case kTypeIdProcessDataRecord: | |
1386 case ModuleInfoRecord::kPersistentTypeId: { | |
1387 const void* memory = allocator_->GetAsArray<char>( | |
1388 ref, type, PersistentMemoryAllocator::kSizeAny); | |
1389 ProcessId found_id; | |
1390 int64_t create_stamp; | |
1391 | |
1392 // By convention, the ProcessInfo structure is always the first | |
1393 // field of the structure so there's no need to handle all the | |
1394 // cases separately. | |
1395 if (ProcessInfo::GetOwningProcessId(memory, &found_id, &create_stamp)) { | |
1396 // Only change the type to be "free" if the process ID matches and | |
1397 // the creation time is before the exit time (so PID re-use doesn't | |
1398 // cause the erasure of something that is in-use). Memory is cleared | |
1399 // here, rather than when it's needed, so as to limit the impact at | |
1400 // that critical time. | |
1401 if (found_id == process_id && create_stamp < exit_stamp) | |
1402 allocator_->ChangeType(ref, ~type, type, /*clear=*/true); | |
1403 } | |
1404 } break; | |
1405 } | |
1406 } | |
1407 } | |
1408 | |
1187 void GlobalActivityTracker::RecordLogMessage(StringPiece message) { | 1409 void GlobalActivityTracker::RecordLogMessage(StringPiece message) { |
1188 // Allocate at least one extra byte so the string is NUL terminated. All | 1410 // Allocate at least one extra byte so the string is NUL terminated. All |
1189 // memory returned by the allocator is guaranteed to be zeroed. | 1411 // memory returned by the allocator is guaranteed to be zeroed. |
1190 PersistentMemoryAllocator::Reference ref = | 1412 PersistentMemoryAllocator::Reference ref = |
1191 allocator_->Allocate(message.size() + 1, kTypeIdGlobalLogMessage); | 1413 allocator_->Allocate(message.size() + 1, kTypeIdGlobalLogMessage); |
1192 char* memory = allocator_->GetAsArray<char>(ref, kTypeIdGlobalLogMessage, | 1414 char* memory = allocator_->GetAsArray<char>(ref, kTypeIdGlobalLogMessage, |
1193 message.size() + 1); | 1415 message.size() + 1); |
1194 if (memory) { | 1416 if (memory) { |
1195 memcpy(memory, message.data(), message.size()); | 1417 memcpy(memory, message.data(), message.size()); |
1196 allocator_->MakeIterable(ref); | 1418 allocator_->MakeIterable(ref); |
(...skipping 43 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
1240 kTypeIdActivityTracker, | 1462 kTypeIdActivityTracker, |
1241 kTypeIdActivityTrackerFree, | 1463 kTypeIdActivityTrackerFree, |
1242 stack_memory_size_, | 1464 stack_memory_size_, |
1243 kCachedThreadMemories, | 1465 kCachedThreadMemories, |
1244 /*make_iterable=*/true), | 1466 /*make_iterable=*/true), |
1245 user_data_allocator_(allocator_.get(), | 1467 user_data_allocator_(allocator_.get(), |
1246 kTypeIdUserDataRecord, | 1468 kTypeIdUserDataRecord, |
1247 kTypeIdUserDataRecordFree, | 1469 kTypeIdUserDataRecordFree, |
1248 kUserDataSize, | 1470 kUserDataSize, |
1249 kCachedUserDataMemories, | 1471 kCachedUserDataMemories, |
1250 /*make_iterable=*/false), | 1472 /*make_iterable=*/true), |
1473 process_data_(allocator_->GetAsArray<char>( | |
1474 AllocateFrom(allocator_.get(), | |
1475 kTypeIdProcessDataRecordFree, | |
1476 kProcessDataSize, | |
1477 kTypeIdProcessDataRecord), | |
1478 kTypeIdProcessDataRecord, | |
1479 kProcessDataSize), | |
1480 kProcessDataSize), | |
1251 global_data_( | 1481 global_data_( |
1252 allocator_->GetAsArray<char>( | 1482 allocator_->GetAsArray<char>( |
1253 allocator_->Allocate(kGlobalDataSize, kTypeIdGlobalDataRecord), | 1483 allocator_->Allocate(kGlobalDataSize, kTypeIdGlobalDataRecord), |
1254 kTypeIdGlobalDataRecord, | 1484 kTypeIdGlobalDataRecord, |
1255 PersistentMemoryAllocator::kSizeAny), | 1485 kGlobalDataSize), |
1256 kGlobalDataSize) { | 1486 kGlobalDataSize) { |
1257 // Ensure the passed memory is valid and empty (iterator finds nothing). | 1487 // Ensure the passed memory is valid and empty (iterator finds nothing). |
1258 uint32_t type; | 1488 uint32_t type; |
1259 DCHECK(!PersistentMemoryAllocator::Iterator(allocator_.get()).GetNext(&type)); | 1489 DCHECK(!PersistentMemoryAllocator::Iterator(allocator_.get()).GetNext(&type)); |
1260 | 1490 |
1261 // Ensure that there is no other global object and then make this one such. | 1491 // Ensure that there is no other global object and then make this one such. |
1262 DCHECK(!g_tracker_); | 1492 DCHECK(!g_tracker_); |
1263 subtle::Release_Store(&g_tracker_, reinterpret_cast<uintptr_t>(this)); | 1493 subtle::Release_Store(&g_tracker_, reinterpret_cast<uintptr_t>(this)); |
1264 | 1494 |
1265 // The global records must be iterable in order to be found by an analyzer. | 1495 // The data records must be iterable in order to be found by an analyzer. |
1496 allocator_->MakeIterable(allocator_->GetAsReference( | |
1497 process_data_.GetBaseAddress(), kTypeIdProcessDataRecord)); | |
1266 allocator_->MakeIterable(allocator_->GetAsReference( | 1498 allocator_->MakeIterable(allocator_->GetAsReference( |
1267 global_data_.GetBaseAddress(), kTypeIdGlobalDataRecord)); | 1499 global_data_.GetBaseAddress(), kTypeIdGlobalDataRecord)); |
1268 | 1500 |
1501 // Note that this process has launched. | |
1502 SetProcessPhase(PROCESS_LAUNCHED); | |
1503 | |
1269 // Fetch and record all activated field trials. | 1504 // Fetch and record all activated field trials. |
1270 FieldTrial::ActiveGroups active_groups; | 1505 FieldTrial::ActiveGroups active_groups; |
1271 FieldTrialList::GetActiveFieldTrialGroups(&active_groups); | 1506 FieldTrialList::GetActiveFieldTrialGroups(&active_groups); |
1272 for (auto& group : active_groups) | 1507 for (auto& group : active_groups) |
1273 RecordFieldTrial(group.trial_name, group.group_name); | 1508 RecordFieldTrial(group.trial_name, group.group_name); |
1274 } | 1509 } |
1275 | 1510 |
1276 GlobalActivityTracker::~GlobalActivityTracker() { | 1511 GlobalActivityTracker::~GlobalActivityTracker() { |
1277 DCHECK_EQ(Get(), this); | 1512 DCHECK_EQ(Get(), this); |
1278 DCHECK_EQ(0, thread_tracker_count_.load(std::memory_order_relaxed)); | 1513 DCHECK_EQ(0, thread_tracker_count_.load(std::memory_order_relaxed)); |
1279 subtle::Release_Store(&g_tracker_, 0); | 1514 subtle::Release_Store(&g_tracker_, 0); |
1515 SetProcessPhase(PROCESS_EXITED_CLEANLY); | |
1280 } | 1516 } |
1281 | 1517 |
1282 void GlobalActivityTracker::ReturnTrackerMemory( | 1518 void GlobalActivityTracker::ReturnTrackerMemory( |
1283 ManagedActivityTracker* tracker) { | 1519 ManagedActivityTracker* tracker) { |
1284 PersistentMemoryAllocator::Reference mem_reference = tracker->mem_reference_; | 1520 PersistentMemoryAllocator::Reference mem_reference = tracker->mem_reference_; |
1285 void* mem_base = tracker->mem_base_; | 1521 void* mem_base = tracker->mem_base_; |
1286 DCHECK(mem_reference); | 1522 DCHECK(mem_reference); |
1287 DCHECK(mem_base); | 1523 DCHECK(mem_base); |
1288 | 1524 |
1289 // Remove the destructed tracker from the set of known ones. | 1525 // Remove the destructed tracker from the set of known ones. |
(...skipping 88 matching lines...) Expand 10 before | Expand all | Expand 10 after Loading... | |
1378 : GlobalActivityTracker::ScopedThreadActivity( | 1614 : GlobalActivityTracker::ScopedThreadActivity( |
1379 program_counter, | 1615 program_counter, |
1380 nullptr, | 1616 nullptr, |
1381 Activity::ACT_PROCESS_WAIT, | 1617 Activity::ACT_PROCESS_WAIT, |
1382 ActivityData::ForProcess(process->Pid()), | 1618 ActivityData::ForProcess(process->Pid()), |
1383 /*lock_allowed=*/true) {} | 1619 /*lock_allowed=*/true) {} |
1384 #endif | 1620 #endif |
1385 | 1621 |
1386 } // namespace debug | 1622 } // namespace debug |
1387 } // namespace base | 1623 } // namespace base |
OLD | NEW |